ChemNet > CAS > 22817-26-1 2,3-Dihydro-1H-benz[de]isoquinoline
22817-26-1 2,3-Dihydro-1H-benz[de]isoquinoline
نام محصول |
2,3-Dihydro-1H-benz[de]isoquinoline |
نام انگلیسی |
2,3-Dihydro-1H-benz[de]isoquinoline;2,3-dihydro-1H-benzo[de]isoquinoline |
میدان مغناطیسی |
C12H11N |
وزن مولکولی |
169.2224 |
InChI |
InChI=1/C12H11N/c1-3-9-4-2-6-11-8-13-7-10(5-1)12(9)11/h1-6,13H,7-8H2 |
شماره سیایاس |
22817-26-1 |
ساختار مولکولی |
|
تراکم |
1.138g/cm3 |
نقطه غلیان |
334.8°C at 760 mmHg |
ضریب شکست |
1.661 |
نقطه اشتعال |
171.2°C |
فشار بخار |
0.000125mmHg at 25°C |
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|